C8H8F3N7O — CID 114185590
2-hydrazinyl-N-(1,2,4-oxadiazol-3-ylmethyl)-6-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 114185590) has the molecular formula C8H8F3N7O and a molecular weight of 275.19 g/mol. Its IUPAC name is 2-hydrazinyl-N-(1,2,4-oxadiazol-3-ylmethyl)-6-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | 2-hydrazinyl-N-(1,2,4-oxadiazol-3-ylmethyl)-6-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 114185590 |
| Molecular Formula | C8H8F3N7O |
| Molecular Weight | 275.19 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 2-hydrazinyl-N-(1,2,4-oxadiazol-3-ylmethyl)-6-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | NNc1nc(NCc2ncon2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C8H8F3N7O/c9-8(10,11)4-1-5(16-7(15-4)17-12)13-2-6-14-3-19-18-6/h1,3H,2,12H2,(H2,13,15,16,17) |
| InChIKey | SMMCBTINDQNLGR-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.19 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|