C13H15N3O3 — CID 114185805
4-[[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]methyl]benzoic acid (PubChem CID 114185805) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is 4-[[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]methyl]benzoic acid.
| Compound Name | 4-[[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 114185805 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 4-[[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]methyl]benzoic acid |
| SMILES | Cc1noc(CCNCc2ccc(C(=O)O)cc2)n1 |
| InChI | InChI=1S/C13H15N3O3/c1-9-15-12(19-16-9)6-7-14-8-10-2-4-11(5-3-10)13(17)18/h2-5,14H,6-8H2,1H3,(H,17,18) |
| InChIKey | DGEFKQNMIZHIFN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|