C12H19N3O3 — CID 114186506
methyl 2-ethyl-4-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]but-2-enoate (PubChem CID 114186506) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is methyl 2-ethyl-4-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]but-2-enoate.
| Compound Name | methyl 2-ethyl-4-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]but-2-enoate |
|---|---|
| PubChem CID | 114186506 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | methyl 2-ethyl-4-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]but-2-enoate |
| SMILES | CCC(=CCNCCc1nc(C)no1)C(=O)OC |
| InChI | InChI=1S/C12H19N3O3/c1-4-10(12(16)17-3)5-7-13-8-6-11-14-9(2)15-18-11/h5,13H,4,6-8H2,1-3H3 |
| InChIKey | HYAGKPWYSFCYDK-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|