C13H22F3NS — CID 114187492
(1R,4S)-1,3,3-trimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]bicyclo[2.2.1]heptan-2-amine (PubChem CID 114187492) has the molecular formula C13H22F3NS and a molecular weight of 281.39 g/mol. Its IUPAC name is (1R,4S)-1,3,3-trimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]bicyclo[2.2.1]heptan-2-amine.
| Compound Name | (1R,4S)-1,3,3-trimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]bicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 114187492 |
| Molecular Formula | C13H22F3NS |
| Molecular Weight | 281.39 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (1R,4S)-1,3,3-trimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]bicyclo[2.2.1]heptan-2-amine |
| SMILES | CC1(C)C(NCCSC(F)(F)F)[C@]2(C)CC[C@H]1C2 |
| InChI | InChI=1S/C13H22F3NS/c1-11(2)9-4-5-12(3,8-9)10(11)17-6-7-18-13(14,15)16/h9-10,17H,4-8H2,1-3H3/t9-,10?,12+/m0/s1 |
| InChIKey | NEOGNUWTSQEDCN-VXFCFVAISA-N |
| XLogP | 4.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|