C23H17ClN2O4 — CID 11418750
N-[4-chloro-2-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]-3-methoxybenzamide (PubChem CID 11418750) has the molecular formula C23H17ClN2O4 and a molecular weight of 420.85 g/mol. Its IUPAC name is N-[4-chloro-2-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]-3-methoxybenzamide.
| Compound Name | N-[4-chloro-2-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 11418750 |
| Molecular Formula | C23H17ClN2O4 |
| Molecular Weight | 420.85 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | N-[4-chloro-2-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)Nc2ccc(Cl)cc2CN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C23H17ClN2O4/c1-30-17-6-4-5-14(12-17)21(27)25-20-10-9-16(24)11-15(20)13-26-22(28)18-7-2-3-8-19(18)23(26)29/h2-12H,13H2,1H3,(H,25,27) |
| InChIKey | URSPQVYFZHQLIN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.85 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|