C9H15F3N4S — CID 114187729
N-[(2-propan-2-yl-1,2,4-triazol-3-yl)methyl]-2-(trifluoromethylsulfanyl)ethanamine (PubChem CID 114187729) has the molecular formula C9H15F3N4S and a molecular weight of 268.31 g/mol. Its IUPAC name is N-[(2-propan-2-yl-1,2,4-triazol-3-yl)methyl]-2-(trifluoromethylsulfanyl)ethanamine.
| Compound Name | N-[(2-propan-2-yl-1,2,4-triazol-3-yl)methyl]-2-(trifluoromethylsulfanyl)ethanamine |
|---|---|
| PubChem CID | 114187729 |
| Molecular Formula | C9H15F3N4S |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | N-[(2-propan-2-yl-1,2,4-triazol-3-yl)methyl]-2-(trifluoromethylsulfanyl)ethanamine |
| SMILES | CC(C)n1ncnc1CNCCSC(F)(F)F |
| InChI | InChI=1S/C9H15F3N4S/c1-7(2)16-8(14-6-15-16)5-13-3-4-17-9(10,11)12/h6-7,13H,3-5H2,1-2H3 |
| InChIKey | LVJMBDKONDFMSJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|