C22H24ClN7 — CID 11418777
N-(2-chloro-6-methylphenyl)-12-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-amine (PubChem CID 11418777) has the molecular formula C22H24ClN7 and a molecular weight of 421.94 g/mol. Its IUPAC name is N-(2-chloro-6-methylphenyl)-12-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-amine.
| Compound Name | N-(2-chloro-6-methylphenyl)-12-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-amine |
|---|---|
| PubChem CID | 11418777 |
| Molecular Formula | C22H24ClN7 |
| Molecular Weight | 421.94 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | N-(2-chloro-6-methylphenyl)-12-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-amine |
| SMILES | Cc1cccc(Cl)c1Nc1nc2ccc(N3C[C@@H](C)N[C@@H](C)C3)nc2n2cncc12 |
| InChI | InChI=1S/C22H24ClN7/c1-13-5-4-6-16(23)20(13)28-21-18-9-24-12-30(18)22-17(26-21)7-8-19(27-22)29-10-14(2)25-15(3)11-29/h4-9,12,14-15,25H,10-11H2,1-3H3,(H,26,28)/t14-,15+ |
| InChIKey | OUHRNSKWYMMRQI-GASCZTMLSA-N |
| XLogP | 4.17 |
| TPSA | 70.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.94 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |