C10H9ClF3N3S2 — CID 114188160
2-chloro-6-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 114188160) has the molecular formula C10H9ClF3N3S2 and a molecular weight of 327.78 g/mol. Its IUPAC name is 2-chloro-6-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-chloro-6-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 114188160 |
| Molecular Formula | C10H9ClF3N3S2 |
| Molecular Weight | 327.78 g/mol |
| Exact Mass | 326.99 |
| IUPAC Name | 2-chloro-6-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1cc2c(NCCSC(F)(F)F)nc(Cl)nc2s1 |
| InChI | InChI=1S/C10H9ClF3N3S2/c1-5-4-6-7(15-2-3-18-10(12,13)14)16-9(11)17-8(6)19-5/h4H,2-3H2,1H3,(H,15,16,17) |
| InChIKey | ZFOZUMBMMWUQME-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.78 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|