C9H11F3N4OS — CID 114188216
5-cyclopropyl-N-[2-(trifluoromethylsulfanyl)ethyl]-1H-1,2,4-triazole-3-carboxamide (PubChem CID 114188216) has the molecular formula C9H11F3N4OS and a molecular weight of 280.28 g/mol. Its IUPAC name is 5-cyclopropyl-N-[2-(trifluoromethylsulfanyl)ethyl]-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-cyclopropyl-N-[2-(trifluoromethylsulfanyl)ethyl]-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 114188216 |
| Molecular Formula | C9H11F3N4OS |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 5-cyclopropyl-N-[2-(trifluoromethylsulfanyl)ethyl]-1H-1,2,4-triazole-3-carboxamide |
| SMILES | O=C(NCCSC(F)(F)F)c1n[nH]c(C2CC2)n1 |
| InChI | InChI=1S/C9H11F3N4OS/c10-9(11,12)18-4-3-13-8(17)7-14-6(15-16-7)5-1-2-5/h5H,1-4H2,(H,13,17)(H,14,15,16) |
| InChIKey | QNPNATALALVPAV-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|