C26H19NO5 — CID 11418865
2-[[4-(4-hydroxyphenyl)-3-phenoxybenzoyl]amino]benzoic acid (PubChem CID 11418865) has the molecular formula C26H19NO5 and a molecular weight of 425.44 g/mol. Its IUPAC name is 2-[[4-(4-hydroxyphenyl)-3-phenoxybenzoyl]amino]benzoic acid.
| Compound Name | 2-[[4-(4-hydroxyphenyl)-3-phenoxybenzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 11418865 |
| Molecular Formula | C26H19NO5 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 2-[[4-(4-hydroxyphenyl)-3-phenoxybenzoyl]amino]benzoic acid |
| SMILES | O=C(Nc1ccccc1C(=O)O)c1ccc(-c2ccc(O)cc2)c(Oc2ccccc2)c1 |
| InChI | InChI=1S/C26H19NO5/c28-19-13-10-17(11-14-19)21-15-12-18(16-24(21)32-20-6-2-1-3-7-20)25(29)27-23-9-5-4-8-22(23)26(30)31/h1-16,28H,(H,27,29)(H,30,31) |
| InChIKey | NXEPOXSASDLOMN-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |