C14H17ClO3 — CID 114188864
(E)-5-chloro-2-[(3-methoxyphenyl)methyl]-4-methylpent-4-enoic acid (PubChem CID 114188864) has the molecular formula C14H17ClO3 and a molecular weight of 268.74 g/mol. Its IUPAC name is (E)-5-chloro-2-[(3-methoxyphenyl)methyl]-4-methylpent-4-enoic acid.
| Compound Name | (E)-5-chloro-2-[(3-methoxyphenyl)methyl]-4-methylpent-4-enoic acid |
|---|---|
| PubChem CID | 114188864 |
| Molecular Formula | C14H17ClO3 |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | (E)-5-chloro-2-[(3-methoxyphenyl)methyl]-4-methylpent-4-enoic acid |
| SMILES | COc1cccc(CC(C/C(C)=C/Cl)C(=O)O)c1 |
| InChI | InChI=1S/C14H17ClO3/c1-10(9-15)6-12(14(16)17)7-11-4-3-5-13(8-11)18-2/h3-5,8-9,12H,6-7H2,1-2H3,(H,16,17)/b10-9+ |
| InChIKey | FXWSKAIYQFIFNC-MDZDMXLPSA-N |
| XLogP | 3.47 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |