C22H19F3N4O2 — CID 11418938
N-[[3-[[2-oxo-4-(3,4,5-trifluorophenyl)pyrrolidin-1-yl]methyl]imidazol-4-yl]methyl]benzamide (PubChem CID 11418938) has the molecular formula C22H19F3N4O2 and a molecular weight of 428.41 g/mol. Its IUPAC name is N-[[3-[[2-oxo-4-(3,4,5-trifluorophenyl)pyrrolidin-1-yl]methyl]imidazol-4-yl]methyl]benzamide.
| Compound Name | N-[[3-[[2-oxo-4-(3,4,5-trifluorophenyl)pyrrolidin-1-yl]methyl]imidazol-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 11418938 |
| Molecular Formula | C22H19F3N4O2 |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | N-[[3-[[2-oxo-4-(3,4,5-trifluorophenyl)pyrrolidin-1-yl]methyl]imidazol-4-yl]methyl]benzamide |
| SMILES | O=C(NCc1cncn1CN1CC(c2cc(F)c(F)c(F)c2)CC1=O)c1ccccc1 |
| InChI | InChI=1S/C22H19F3N4O2/c23-18-6-15(7-19(24)21(18)25)16-8-20(30)28(11-16)13-29-12-26-9-17(29)10-27-22(31)14-4-2-1-3-5-14/h1-7,9,12,16H,8,10-11,13H2,(H,27,31) |
| InChIKey | YDGYWBNOIIXKPO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|