C21H23F3O4S — CID 11418941
2-[2-methyl-4-[2-[[4-(trifluoromethyl)phenoxy]methyl]butylsulfanyl]phenoxy]acetic acid (PubChem CID 11418941) has the molecular formula C21H23F3O4S and a molecular weight of 428.47 g/mol. Its IUPAC name is 2-[2-methyl-4-[2-[[4-(trifluoromethyl)phenoxy]methyl]butylsulfanyl]phenoxy]acetic acid.
| Compound Name | 2-[2-methyl-4-[2-[[4-(trifluoromethyl)phenoxy]methyl]butylsulfanyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 11418941 |
| Molecular Formula | C21H23F3O4S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 2-[2-methyl-4-[2-[[4-(trifluoromethyl)phenoxy]methyl]butylsulfanyl]phenoxy]acetic acid |
| SMILES | CCC(COc1ccc(C(F)(F)F)cc1)CSc1ccc(OCC(=O)O)c(C)c1 |
| InChI | InChI=1S/C21H23F3O4S/c1-3-15(11-27-17-6-4-16(5-7-17)21(22,23)24)13-29-18-8-9-19(14(2)10-18)28-12-20(25)26/h4-10,15H,3,11-13H2,1-2H3,(H,25,26) |
| InChIKey | KSCZMOSACZKJJW-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |