C15H21NO — CID 114189772
[2-(4,4-dimethylpent-2-ynoxy)-5-methylphenyl]methanamine (PubChem CID 114189772) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is [2-(4,4-dimethylpent-2-ynoxy)-5-methylphenyl]methanamine.
| Compound Name | [2-(4,4-dimethylpent-2-ynoxy)-5-methylphenyl]methanamine |
|---|---|
| PubChem CID | 114189772 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | [2-(4,4-dimethylpent-2-ynoxy)-5-methylphenyl]methanamine |
| SMILES | Cc1ccc(OCC#CC(C)(C)C)c(CN)c1 |
| InChI | InChI=1S/C15H21NO/c1-12-6-7-14(13(10-12)11-16)17-9-5-8-15(2,3)4/h6-7,10H,9,11,16H2,1-4H3 |
| InChIKey | BVURFGNYWAQJSD-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|