C15H25NO2 — CID 114190047
1-(4,4-dimethylpent-2-ynyl)-3-ethylpiperidine-3-carboxylic acid (PubChem CID 114190047) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 1-(4,4-dimethylpent-2-ynyl)-3-ethylpiperidine-3-carboxylic acid.
| Compound Name | 1-(4,4-dimethylpent-2-ynyl)-3-ethylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 114190047 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 1-(4,4-dimethylpent-2-ynyl)-3-ethylpiperidine-3-carboxylic acid |
| SMILES | CCC1(C(=O)O)CCCN(CC#CC(C)(C)C)C1 |
| InChI | InChI=1S/C15H25NO2/c1-5-15(13(17)18)9-7-11-16(12-15)10-6-8-14(2,3)4/h5,7,9-12H2,1-4H3,(H,17,18) |
| InChIKey | PRHHRLRDPGSLDM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|