About 1-(1,4-dimethylpiperazin-2-yl)-5,5-dimethylhex-3-yn-1-ol
1-(1,4-dimethylpiperazin-2-yl)-5,5-dimethylhex-3-yn-1-ol (PubChem CID 114190180) has the molecular formula C14H26N2O
and a molecular weight of 238.37 g/mol. Its IUPAC name is 1-(1,4-dimethylpiperazin-2-yl)-5,5-dimethylhex-3-yn-1-ol.
Molecular Properties
| Compound Name | 1-(1,4-dimethylpiperazin-2-yl)-5,5-dimethylhex-3-yn-1-ol |
| PubChem CID | 114190180 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | 1-(1,4-dimethylpiperazin-2-yl)-5,5-dimethylhex-3-yn-1-ol |
| SMILES | CN1CCN(C)C(C(O)CC#CC(C)(C)C)C1 |
| InChI | InChI=1S/C14H26N2O/c1-14(2,3)8-6-7-13(17)12-11-15(4)9-10-16(12)5/h12-13,17H,7,9-11H2,1-5H3 |
| InChIKey | KPMHLLMXHSSXNG-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,4-dimethylpiperazin-2-yl)-5,5-dimethylhex-3-yn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,4-dimethylpiperazin-2-yl)-5,5-dimethylhex-3-yn-1-ol?
The IUPAC name of 1-(1,4-dimethylpiperazin-2-yl)-5,5-dimethylhex-3-yn-1-ol (CID 114190180) is 1-(1,4-dimethylpiperazin-2-yl)-5,5-dimethylhex-3-yn-1-ol.
What is the SMILES notation for 1-(1,4-dimethylpiperazin-2-yl)-5,5-dimethylhex-3-yn-1-ol?
The canonical SMILES for 1-(1,4-dimethylpiperazin-2-yl)-5,5-dimethylhex-3-yn-1-ol is CN1CCN(C)C(C(O)CC#CC(C)(C)C)C1.
What is the InChIKey of 1-(1,4-dimethylpiperazin-2-yl)-5,5-dimethylhex-3-yn-1-ol?
The InChIKey is KPMHLLMXHSSXNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O/c1-14(2,3)8-6-7-13(17)12-11-15(4)9-10-16(12)5/h12-13,17H,7,9-11H2,1-5H3.
What are the key properties of 1-(1,4-dimethylpiperazin-2-yl)-5,5-dimethylhex-3-yn-1-ol?
1-(1,4-dimethylpiperazin-2-yl)-5,5-dimethylhex-3-yn-1-ol has a molecular weight of 238.37 g/mol, XLogP of 1.03, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,4-dimethylpiperazin-2-yl)-5,5-dimethylhex-3-yn-1-ol is sourced from PubChem (CID 114190180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).