C15H28N2O — CID 114190308
5,5-dimethyl-1-(4-propan-2-ylmorpholin-2-yl)hex-3-yn-1-amine (PubChem CID 114190308) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is 5,5-dimethyl-1-(4-propan-2-ylmorpholin-2-yl)hex-3-yn-1-amine.
| Compound Name | 5,5-dimethyl-1-(4-propan-2-ylmorpholin-2-yl)hex-3-yn-1-amine |
|---|---|
| PubChem CID | 114190308 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | 5,5-dimethyl-1-(4-propan-2-ylmorpholin-2-yl)hex-3-yn-1-amine |
| SMILES | CC(C)N1CCOC(C(N)CC#CC(C)(C)C)C1 |
| InChI | InChI=1S/C15H28N2O/c1-12(2)17-9-10-18-14(11-17)13(16)7-6-8-15(3,4)5/h12-14H,7,9-11,16H2,1-5H3 |
| InChIKey | QCIKRDAYMBXDNA-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|