C15H16ClN — CID 114190429
6-chloro-1-(4,4-dimethylpent-2-ynyl)indole (PubChem CID 114190429) has the molecular formula C15H16ClN and a molecular weight of 245.75 g/mol. Its IUPAC name is 6-chloro-1-(4,4-dimethylpent-2-ynyl)indole.
| Compound Name | 6-chloro-1-(4,4-dimethylpent-2-ynyl)indole |
|---|---|
| PubChem CID | 114190429 |
| Molecular Formula | C15H16ClN |
| Molecular Weight | 245.75 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 6-chloro-1-(4,4-dimethylpent-2-ynyl)indole |
| SMILES | CC(C)(C)C#CCn1ccc2ccc(Cl)cc21 |
| InChI | InChI=1S/C15H16ClN/c1-15(2,3)8-4-9-17-10-7-12-5-6-13(16)11-14(12)17/h5-7,10-11H,9H2,1-3H3 |
| InChIKey | PZYIISZTKLXUNY-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.75 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|