C16H30N2 — CID 114190436
N-[[1-(4,4-dimethylpent-2-ynyl)piperidin-4-yl]methyl]propan-1-amine (PubChem CID 114190436) has the molecular formula C16H30N2 and a molecular weight of 250.43 g/mol. Its IUPAC name is N-[[1-(4,4-dimethylpent-2-ynyl)piperidin-4-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-(4,4-dimethylpent-2-ynyl)piperidin-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 114190436 |
| Molecular Formula | C16H30N2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.24 |
| IUPAC Name | N-[[1-(4,4-dimethylpent-2-ynyl)piperidin-4-yl]methyl]propan-1-amine |
| SMILES | CCCNCC1CCN(CC#CC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H30N2/c1-5-10-17-14-15-7-12-18(13-8-15)11-6-9-16(2,3)4/h15,17H,5,7-8,10-14H2,1-4H3 |
| InChIKey | HRZDTUFVTVLPKS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|