C18H19FN4O8 — CID 11419237
[(2S,3R,4S,5S,6S)-3,5-diacetyloxy-2-azido-6-[(4-fluorophenyl)carbamoyl]oxan-4-yl] acetate (PubChem CID 11419237) has the molecular formula C18H19FN4O8 and a molecular weight of 438.37 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6S)-3,5-diacetyloxy-2-azido-6-[(4-fluorophenyl)carbamoyl]oxan-4-yl] acetate.
| Compound Name | [(2S,3R,4S,5S,6S)-3,5-diacetyloxy-2-azido-6-[(4-fluorophenyl)carbamoyl]oxan-4-yl] acetate |
|---|---|
| PubChem CID | 11419237 |
| Molecular Formula | C18H19FN4O8 |
| Molecular Weight | 438.37 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | [(2S,3R,4S,5S,6S)-3,5-diacetyloxy-2-azido-6-[(4-fluorophenyl)carbamoyl]oxan-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@@H](N=[N+]=[N-])O[C@H](C(=O)Nc2ccc(F)cc2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C18H19FN4O8/c1-8(24)28-13-14(29-9(2)25)16(30-10(3)26)18(22-23-20)31-15(13)17(27)21-12-6-4-11(19)5-7-12/h4-7,13-16,18H,1-3H3,(H,21,27)/t13-,14-,15-,16+,18-/m0/s1 |
| InChIKey | FONAZLWLCTUTCG-FDPKGLCPSA-N |
| XLogP | 1.59 |
| TPSA | 165.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.37 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|