C26H24O7 — CID 11419500
methyl (4S,4'aS,5S,5'R,8'aS)-5'-hydroxy-4',8'-dioxo-4,5-diphenylspiro[1,3-dioxolane-2,1'-2,3,5,8a-tetrahydronaphthalene]-4'a-carboxylate (PubChem CID 11419500) has the molecular formula C26H24O7 and a molecular weight of 448.47 g/mol. Its IUPAC name is methyl (4S,4'aS,5S,5'R,8'aS)-5'-hydroxy-4',8'-dioxo-4,5-diphenylspiro[1,3-dioxolane-2,1'-2,3,5,8a-tetrahydronaphthalene]-4'a-carboxylate.
| Compound Name | methyl (4S,4'aS,5S,5'R,8'aS)-5'-hydroxy-4',8'-dioxo-4,5-diphenylspiro[1,3-dioxolane-2,1'-2,3,5,8a-tetrahydronaphthalene]-4'a-carboxylate |
|---|---|
| PubChem CID | 11419500 |
| Molecular Formula | C26H24O7 |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | methyl (4S,4'aS,5S,5'R,8'aS)-5'-hydroxy-4',8'-dioxo-4,5-diphenylspiro[1,3-dioxolane-2,1'-2,3,5,8a-tetrahydronaphthalene]-4'a-carboxylate |
| SMILES | COC(=O)[C@@]12C(=O)CCC3(O[C@@H](c4ccccc4)[C@H](c4ccccc4)O3)[C@@H]1C(=O)C=C[C@H]2O |
| InChI | InChI=1S/C26H24O7/c1-31-24(30)26-19(28)13-12-18(27)23(26)25(15-14-20(26)29)32-21(16-8-4-2-5-9-16)22(33-25)17-10-6-3-7-11-17/h2-13,19,21-23,28H,14-15H2,1H3/t19-,21+,22+,23+,26+/m1/s1 |
| InChIKey | LZWCKHDFVNNDMA-KHSUQFHWSA-N |
| XLogP | 2.85 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|