C25H29NO7 — CID 11419680
(2S,3R,4S,5S,6R)-2-[3-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-1-methylindol-4-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 11419680) has the molecular formula C25H29NO7 and a molecular weight of 455.51 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-[3-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-1-methylindol-4-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-[3-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-1-methylindol-4-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 11419680 |
| Molecular Formula | C25H29NO7 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[3-[2-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-1-methylindol-4-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | Cn1cc(CCc2ccc3c(c2)CCO3)c2c(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cccc21 |
| InChI | InChI=1S/C25H29NO7/c1-26-12-16(7-5-14-6-8-18-15(11-14)9-10-31-18)21-17(26)3-2-4-19(21)32-25-24(30)23(29)22(28)20(13-27)33-25/h2-4,6,8,11-12,20,22-25,27-30H,5,7,9-10,13H2,1H3/t20-,22-,23+,24-,25-/m1/s1 |
| InChIKey | WCDHDALKRYVAPN-PRDVQWLOSA-N |
| XLogP | 1.08 |
| TPSA | 113.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |