C20H31N3O7S — CID 11419729
tert-butyl (4S,5R)-4-[[(1S,2R)-2-hydroxy-1-(4-methoxycarbonyl-1,3-thiazol-2-yl)propyl]carbamoyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 11419729) has the molecular formula C20H31N3O7S and a molecular weight of 457.55 g/mol. Its IUPAC name is tert-butyl (4S,5R)-4-[[(1S,2R)-2-hydroxy-1-(4-methoxycarbonyl-1,3-thiazol-2-yl)propyl]carbamoyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S,5R)-4-[[(1S,2R)-2-hydroxy-1-(4-methoxycarbonyl-1,3-thiazol-2-yl)propyl]carbamoyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 11419729 |
| Molecular Formula | C20H31N3O7S |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | tert-butyl (4S,5R)-4-[[(1S,2R)-2-hydroxy-1-(4-methoxycarbonyl-1,3-thiazol-2-yl)propyl]carbamoyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | COC(=O)c1csc([C@@H](NC(=O)[C@@H]2[C@@H](C)OC(C)(C)N2C(=O)OC(C)(C)C)[C@@H](C)O)n1 |
| InChI | InChI=1S/C20H31N3O7S/c1-10(24)13(16-21-12(9-31-16)17(26)28-8)22-15(25)14-11(2)29-20(6,7)23(14)18(27)30-19(3,4)5/h9-11,13-14,24H,1-8H3,(H,22,25)/t10-,11-,13+,14+/m1/s1 |
| InChIKey | AKQLPFIPSOKMML-RFHZTLPTSA-N |
| XLogP | 2.23 |
| TPSA | 127.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |