C22H20N6O2S2 — CID 11419895
N-(1,3-benzodioxol-5-ylmethyl)-4-(8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)piperazine-1-carbothioamide (PubChem CID 11419895) has the molecular formula C22H20N6O2S2 and a molecular weight of 464.58 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-4-(8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)piperazine-1-carbothioamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-4-(8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 11419895 |
| Molecular Formula | C22H20N6O2S2 |
| Molecular Weight | 464.58 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-4-(8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl)piperazine-1-carbothioamide |
| SMILES | S=C(NCc1ccc2c(c1)OCO2)N1CCN(c2ncnc3c2sc2ncccc23)CC1 |
| InChI | InChI=1S/C22H20N6O2S2/c31-22(24-11-14-3-4-16-17(10-14)30-13-29-16)28-8-6-27(7-9-28)20-19-18(25-12-26-20)15-2-1-5-23-21(15)32-19/h1-5,10,12H,6-9,11,13H2,(H,24,31) |
| InChIKey | LYPZZJCXKBVUPO-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 75.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.58 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|