C16H21N5O3S — CID 114199993
tert-butyl N-[4-amino-3-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]phenyl]carbamate (PubChem CID 114199993) has the molecular formula C16H21N5O3S and a molecular weight of 363.44 g/mol. Its IUPAC name is tert-butyl N-[4-amino-3-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-amino-3-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]phenyl]carbamate |
|---|---|
| PubChem CID | 114199993 |
| Molecular Formula | C16H21N5O3S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | tert-butyl N-[4-amino-3-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(N)c(Sc2n[nH]c(=O)n2C2CC2)c1 |
| InChI | InChI=1S/C16H21N5O3S/c1-16(2,3)24-15(23)18-9-4-7-11(17)12(8-9)25-14-20-19-13(22)21(14)10-5-6-10/h4,7-8,10H,5-6,17H2,1-3H3,(H,18,23)(H,19,22) |
| InChIKey | CKNULMOQVXXALV-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 115.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|