C14H27N3 — CID 114200203
2-[4-(2,4-dimethylpentyl)piperazin-1-yl]propanenitrile (PubChem CID 114200203) has the molecular formula C14H27N3 and a molecular weight of 237.39 g/mol. Its IUPAC name is 2-[4-(2,4-dimethylpentyl)piperazin-1-yl]propanenitrile.
| Compound Name | 2-[4-(2,4-dimethylpentyl)piperazin-1-yl]propanenitrile |
|---|---|
| PubChem CID | 114200203 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | 2-[4-(2,4-dimethylpentyl)piperazin-1-yl]propanenitrile |
| SMILES | CC(C)CC(C)CN1CCN(C(C)C#N)CC1 |
| InChI | InChI=1S/C14H27N3/c1-12(2)9-13(3)11-16-5-7-17(8-6-16)14(4)10-15/h12-14H,5-9,11H2,1-4H3 |
| InChIKey | VAFOLVZUSJMCHC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |