C13H20F3NO — CID 114200417
1-[1-(2,4-dimethylpentyl)pyrrol-3-yl]-2,2,2-trifluoroethanol (PubChem CID 114200417) has the molecular formula C13H20F3NO and a molecular weight of 263.30 g/mol. Its IUPAC name is 1-[1-(2,4-dimethylpentyl)pyrrol-3-yl]-2,2,2-trifluoroethanol.
| Compound Name | 1-[1-(2,4-dimethylpentyl)pyrrol-3-yl]-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 114200417 |
| Molecular Formula | C13H20F3NO |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 1-[1-(2,4-dimethylpentyl)pyrrol-3-yl]-2,2,2-trifluoroethanol |
| SMILES | CC(C)CC(C)Cn1ccc(C(O)C(F)(F)F)c1 |
| InChI | InChI=1S/C13H20F3NO/c1-9(2)6-10(3)7-17-5-4-11(8-17)12(18)13(14,15)16/h4-5,8-10,12,18H,6-7H2,1-3H3 |
| InChIKey | BCASLTNHYNWPAW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |