C13H19ClN2O2 — CID 114200576
4-chloro-N-(2,4-dimethylpentyl)-3-nitroaniline (PubChem CID 114200576) has the molecular formula C13H19ClN2O2 and a molecular weight of 270.76 g/mol. Its IUPAC name is 4-chloro-N-(2,4-dimethylpentyl)-3-nitroaniline.
| Compound Name | 4-chloro-N-(2,4-dimethylpentyl)-3-nitroaniline |
|---|---|
| PubChem CID | 114200576 |
| Molecular Formula | C13H19ClN2O2 |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 4-chloro-N-(2,4-dimethylpentyl)-3-nitroaniline |
| SMILES | CC(C)CC(C)CNc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H19ClN2O2/c1-9(2)6-10(3)8-15-11-4-5-12(14)13(7-11)16(17)18/h4-5,7,9-10,15H,6,8H2,1-3H3 |
| InChIKey | SBYTWZNJNZKIFV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|