C27H25F3N2O3 — CID 11420272
1-[[4-[(Z)-C-methyl-N-[[4-phenyl-3-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenyl]methyl]azetidine-3-carboxylic acid (PubChem CID 11420272) has the molecular formula C27H25F3N2O3 and a molecular weight of 482.50 g/mol. Its IUPAC name is 1-[[4-[(Z)-C-methyl-N-[[4-phenyl-3-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenyl]methyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[[4-[(Z)-C-methyl-N-[[4-phenyl-3-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenyl]methyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 11420272 |
| Molecular Formula | C27H25F3N2O3 |
| Molecular Weight | 482.50 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | 1-[[4-[(Z)-C-methyl-N-[[4-phenyl-3-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenyl]methyl]azetidine-3-carboxylic acid |
| SMILES | C/C(=N/OCc1ccc(-c2ccccc2)c(C(F)(F)F)c1)c1ccc(CN2CC(C(=O)O)C2)cc1 |
| InChI | InChI=1S/C27H25F3N2O3/c1-18(21-10-7-19(8-11-21)14-32-15-23(16-32)26(33)34)31-35-17-20-9-12-24(22-5-3-2-4-6-22)25(13-20)27(28,29)30/h2-13,23H,14-17H2,1H3,(H,33,34)/b31-18- |
| InChIKey | BXLZLJZXXFKXLR-MNBJERMJSA-N |
| XLogP | 5.83 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.50 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|