About N-(1-cyclopropylbutan-2-yl)-3-methyl-[1,2]thiazolo[5,4-d]pyrimidin-4-amine
N-(1-cyclopropylbutan-2-yl)-3-methyl-[1,2]thiazolo[5,4-d]pyrimidin-4-amine (PubChem CID 114203179) has the molecular formula C13H18N4S
and a molecular weight of 262.38 g/mol. Its IUPAC name is N-(1-cyclopropylbutan-2-yl)-3-methyl-[1,2]thiazolo[5,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-(1-cyclopropylbutan-2-yl)-3-methyl-[1,2]thiazolo[5,4-d]pyrimidin-4-amine |
| PubChem CID | 114203179 |
| Molecular Formula | C13H18N4S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N-(1-cyclopropylbutan-2-yl)-3-methyl-[1,2]thiazolo[5,4-d]pyrimidin-4-amine |
| SMILES | CCC(CC1CC1)Nc1ncnc2snc(C)c12 |
| InChI | InChI=1S/C13H18N4S/c1-3-10(6-9-4-5-9)16-12-11-8(2)17-18-13(11)15-7-14-12/h7,9-10H,3-6H2,1-2H3,(H,14,15,16) |
| InChIKey | ZHHKTVXTUHGGJE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1-cyclopropylbutan-2-yl)-3-methyl-[1,2]thiazolo[5,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-cyclopropylbutan-2-yl)-3-methyl-[1,2]thiazolo[5,4-d]pyrimidin-4-amine?
The IUPAC name of N-(1-cyclopropylbutan-2-yl)-3-methyl-[1,2]thiazolo[5,4-d]pyrimidin-4-amine (CID 114203179) is N-(1-cyclopropylbutan-2-yl)-3-methyl-[1,2]thiazolo[5,4-d]pyrimidin-4-amine.
What is the SMILES notation for N-(1-cyclopropylbutan-2-yl)-3-methyl-[1,2]thiazolo[5,4-d]pyrimidin-4-amine?
The canonical SMILES for N-(1-cyclopropylbutan-2-yl)-3-methyl-[1,2]thiazolo[5,4-d]pyrimidin-4-amine is CCC(CC1CC1)Nc1ncnc2snc(C)c12.
What is the InChIKey of N-(1-cyclopropylbutan-2-yl)-3-methyl-[1,2]thiazolo[5,4-d]pyrimidin-4-amine?
The InChIKey is ZHHKTVXTUHGGJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4S/c1-3-10(6-9-4-5-9)16-12-11-8(2)17-18-13(11)15-7-14-12/h7,9-10H,3-6H2,1-2H3,(H,14,15,16).
What are the key properties of N-(1-cyclopropylbutan-2-yl)-3-methyl-[1,2]thiazolo[5,4-d]pyrimidin-4-amine?
N-(1-cyclopropylbutan-2-yl)-3-methyl-[1,2]thiazolo[5,4-d]pyrimidin-4-amine has a molecular weight of 262.38 g/mol, XLogP of 3.39, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-cyclopropylbutan-2-yl)-3-methyl-[1,2]thiazolo[5,4-d]pyrimidin-4-amine is sourced from PubChem (CID 114203179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).