C14H25N3 — CID 114204392
N-[[1-(2,2-dimethylcyclopentyl)imidazol-4-yl]methyl]propan-1-amine (PubChem CID 114204392) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is N-[[1-(2,2-dimethylcyclopentyl)imidazol-4-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-(2,2-dimethylcyclopentyl)imidazol-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 114204392 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | N-[[1-(2,2-dimethylcyclopentyl)imidazol-4-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cn(C2CCCC2(C)C)cn1 |
| InChI | InChI=1S/C14H25N3/c1-4-8-15-9-12-10-17(11-16-12)13-6-5-7-14(13,2)3/h10-11,13,15H,4-9H2,1-3H3 |
| InChIKey | ICFJXJBSSLQBMP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|