C14H21ClN2O2 — CID 114205215
5-(chloromethyl)-2-(1-ethoxycycloheptyl)-1H-pyrimidin-6-one (PubChem CID 114205215) has the molecular formula C14H21ClN2O2 and a molecular weight of 284.79 g/mol. Its IUPAC name is 5-(chloromethyl)-2-(1-ethoxycycloheptyl)-1H-pyrimidin-6-one.
| Compound Name | 5-(chloromethyl)-2-(1-ethoxycycloheptyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114205215 |
| Molecular Formula | C14H21ClN2O2 |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 5-(chloromethyl)-2-(1-ethoxycycloheptyl)-1H-pyrimidin-6-one |
| SMILES | CCOC1(c2ncc(CCl)c(=O)[nH]2)CCCCCC1 |
| InChI | InChI=1S/C14H21ClN2O2/c1-2-19-14(7-5-3-4-6-8-14)13-16-10-11(9-15)12(18)17-13/h10H,2-9H2,1H3,(H,16,17,18) |
| InChIKey | WVDMHFIRRYKCTC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|