C15H14ClFN2 — CID 114205468
5-(chloromethyl)-4-cyclopropyl-2-(4-fluoro-2-methylphenyl)pyrimidine (PubChem CID 114205468) has the molecular formula C15H14ClFN2 and a molecular weight of 276.74 g/mol. Its IUPAC name is 5-(chloromethyl)-4-cyclopropyl-2-(4-fluoro-2-methylphenyl)pyrimidine.
| Compound Name | 5-(chloromethyl)-4-cyclopropyl-2-(4-fluoro-2-methylphenyl)pyrimidine |
|---|---|
| PubChem CID | 114205468 |
| Molecular Formula | C15H14ClFN2 |
| Molecular Weight | 276.74 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 5-(chloromethyl)-4-cyclopropyl-2-(4-fluoro-2-methylphenyl)pyrimidine |
| SMILES | Cc1cc(F)ccc1-c1ncc(CCl)c(C2CC2)n1 |
| InChI | InChI=1S/C15H14ClFN2/c1-9-6-12(17)4-5-13(9)15-18-8-11(7-16)14(19-15)10-2-3-10/h4-6,8,10H,2-3,7H2,1H3 |
| InChIKey | SIOAMZCRRRKEDB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.74 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|