C14H14BrN3 — CID 114205826
5-(bromomethyl)-4-cyclopropyl-2-(3-methyl-2-pyridinyl)pyrimidine (PubChem CID 114205826) has the molecular formula C14H14BrN3 and a molecular weight of 304.19 g/mol. Its IUPAC name is 5-(bromomethyl)-4-cyclopropyl-2-(3-methyl-2-pyridinyl)pyrimidine.
| Compound Name | 5-(bromomethyl)-4-cyclopropyl-2-(3-methyl-2-pyridinyl)pyrimidine |
|---|---|
| PubChem CID | 114205826 |
| Molecular Formula | C14H14BrN3 |
| Molecular Weight | 304.19 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 5-(bromomethyl)-4-cyclopropyl-2-(3-methyl-2-pyridinyl)pyrimidine |
| SMILES | Cc1cccnc1-c1ncc(CBr)c(C2CC2)n1 |
| InChI | InChI=1S/C14H14BrN3/c1-9-3-2-6-16-12(9)14-17-8-11(7-15)13(18-14)10-4-5-10/h2-3,6,8,10H,4-5,7H2,1H3 |
| InChIKey | KDXRAEYCPQYFLI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.19 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|