C13H23N3O — CID 114206364
2-butyl-5-[(2-methylpropylamino)methyl]-1H-pyrimidin-6-one (PubChem CID 114206364) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is 2-butyl-5-[(2-methylpropylamino)methyl]-1H-pyrimidin-6-one.
| Compound Name | 2-butyl-5-[(2-methylpropylamino)methyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114206364 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 2-butyl-5-[(2-methylpropylamino)methyl]-1H-pyrimidin-6-one |
| SMILES | CCCCc1ncc(CNCC(C)C)c(=O)[nH]1 |
| InChI | InChI=1S/C13H23N3O/c1-4-5-6-12-15-9-11(13(17)16-12)8-14-7-10(2)3/h9-10,14H,4-8H2,1-3H3,(H,15,16,17) |
| InChIKey | SOCIOKWPERMKAG-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |