C36H38O2 — CID 11420692
3-(3,5-dimethylphenyl)-1-[3-(3,5-dimethylphenyl)-2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 11420692) has the molecular formula C36H38O2 and a molecular weight of 502.70 g/mol. Its IUPAC name is 3-(3,5-dimethylphenyl)-1-[3-(3,5-dimethylphenyl)-2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | 3-(3,5-dimethylphenyl)-1-[3-(3,5-dimethylphenyl)-2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 11420692 |
| Molecular Formula | C36H38O2 |
| Molecular Weight | 502.70 g/mol |
| Exact Mass | 502.29 |
| IUPAC Name | 3-(3,5-dimethylphenyl)-1-[3-(3,5-dimethylphenyl)-2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | Cc1cc(C)cc(-c2cc3c(c(-c4c(O)c(-c5cc(C)cc(C)c5)cc5c4CCCC5)c2O)CCCC3)c1 |
| InChI | InChI=1S/C36H38O2/c1-21-13-22(2)16-27(15-21)31-19-25-9-5-7-11-29(25)33(35(31)37)34-30-12-8-6-10-26(30)20-32(36(34)38)28-17-23(3)14-24(4)18-28/h13-20,37-38H,5-12H2,1-4H3 |
| InChIKey | RSHMDLJRFPHHRE-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.70 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |