C27H38NO4PS — CID 11420712
ethyl-[6-[(1S,4R)-3-[(4-phenylphenyl)sulfonylamino]-2-bicyclo[2.2.1]heptanyl]hexyl]phosphinic acid (PubChem CID 11420712) has the molecular formula C27H38NO4PS and a molecular weight of 503.65 g/mol. Its IUPAC name is ethyl-[6-[(1S,4R)-3-[(4-phenylphenyl)sulfonylamino]-2-bicyclo[2.2.1]heptanyl]hexyl]phosphinic acid.
| Compound Name | ethyl-[6-[(1S,4R)-3-[(4-phenylphenyl)sulfonylamino]-2-bicyclo[2.2.1]heptanyl]hexyl]phosphinic acid |
|---|---|
| PubChem CID | 11420712 |
| Molecular Formula | C27H38NO4PS |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | ethyl-[6-[(1S,4R)-3-[(4-phenylphenyl)sulfonylamino]-2-bicyclo[2.2.1]heptanyl]hexyl]phosphinic acid |
| SMILES | CCP(=O)(O)CCCCCCC1C(NS(=O)(=O)c2ccc(-c3ccccc3)cc2)[C@@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C27H38NO4PS/c1-2-33(29,30)19-9-4-3-8-12-26-23-13-14-24(20-23)27(26)28-34(31,32)25-17-15-22(16-18-25)21-10-6-5-7-11-21/h5-7,10-11,15-18,23-24,26-28H,2-4,8-9,12-14,19-20H2,1H3,(H,29,30)/t23-,24+,26?,27?/m0/s1 |
| InChIKey | UPCNRNZVYDCNHE-YIPSDJECSA-N |
| XLogP | 6.29 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|