About 4-cyclopropyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-5-amine
4-cyclopropyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-5-amine (PubChem CID 114207252) has the molecular formula C11H14F3N3O
and a molecular weight of 261.25 g/mol. Its IUPAC name is 4-cyclopropyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-5-amine.
Molecular Properties
| Compound Name | 4-cyclopropyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-5-amine |
| PubChem CID | 114207252 |
| Molecular Formula | C11H14F3N3O |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 4-cyclopropyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-5-amine |
| SMILES | Nc1cnc(CCOCC(F)(F)F)nc1C1CC1 |
| InChI | InChI=1S/C11H14F3N3O/c12-11(13,14)6-18-4-3-9-16-5-8(15)10(17-9)7-1-2-7/h5,7H,1-4,6,15H2 |
| InChIKey | YZINPZMIDXZHPJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclopropyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopropyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-5-amine?
The IUPAC name of 4-cyclopropyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-5-amine (CID 114207252) is 4-cyclopropyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-5-amine.
What is the SMILES notation for 4-cyclopropyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-5-amine?
The canonical SMILES for 4-cyclopropyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-5-amine is Nc1cnc(CCOCC(F)(F)F)nc1C1CC1.
What is the InChIKey of 4-cyclopropyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-5-amine?
The InChIKey is YZINPZMIDXZHPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F3N3O/c12-11(13,14)6-18-4-3-9-16-5-8(15)10(17-9)7-1-2-7/h5,7H,1-4,6,15H2.
What are the key properties of 4-cyclopropyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-5-amine?
4-cyclopropyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-5-amine has a molecular weight of 261.25 g/mol, XLogP of 2.06, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopropyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidin-5-amine is sourced from PubChem (CID 114207252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).