About 4-hydroxy-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]-6-oxopyridine-2-carboxylic acid
4-hydroxy-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]-6-oxopyridine-2-carboxylic acid (PubChem CID 114207480) has the molecular formula C10H10N4O4
and a molecular weight of 250.21 g/mol. Its IUPAC name is 4-hydroxy-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]-6-oxopyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-hydroxy-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]-6-oxopyridine-2-carboxylic acid |
| PubChem CID | 114207480 |
| Molecular Formula | C10H10N4O4 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 4-hydroxy-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]-6-oxopyridine-2-carboxylic acid |
| SMILES | Cn1cnnc1Cn1c(C(=O)O)cc(O)cc1=O |
| InChI | InChI=1S/C10H10N4O4/c1-13-5-11-12-8(13)4-14-7(10(17)18)2-6(15)3-9(14)16/h2-3,5,15H,4H2,1H3,(H,17,18) |
| InChIKey | FJHKAWKIKFVGIS-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-hydroxy-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]-6-oxopyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]-6-oxopyridine-2-carboxylic acid?
The IUPAC name of 4-hydroxy-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]-6-oxopyridine-2-carboxylic acid (CID 114207480) is 4-hydroxy-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]-6-oxopyridine-2-carboxylic acid.
What is the SMILES notation for 4-hydroxy-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]-6-oxopyridine-2-carboxylic acid?
The canonical SMILES for 4-hydroxy-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]-6-oxopyridine-2-carboxylic acid is Cn1cnnc1Cn1c(C(=O)O)cc(O)cc1=O.
What is the InChIKey of 4-hydroxy-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]-6-oxopyridine-2-carboxylic acid?
The InChIKey is FJHKAWKIKFVGIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4O4/c1-13-5-11-12-8(13)4-14-7(10(17)18)2-6(15)3-9(14)16/h2-3,5,15H,4H2,1H3,(H,17,18).
What are the key properties of 4-hydroxy-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]-6-oxopyridine-2-carboxylic acid?
4-hydroxy-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]-6-oxopyridine-2-carboxylic acid has a molecular weight of 250.21 g/mol, XLogP of -0.57, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]-6-oxopyridine-2-carboxylic acid is sourced from PubChem (CID 114207480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).