About 4-hydroxy-6-oxo-1-[1-(1,3-thiazol-2-yl)propyl]pyridine-2-carboxylic acid
4-hydroxy-6-oxo-1-[1-(1,3-thiazol-2-yl)propyl]pyridine-2-carboxylic acid (PubChem CID 114207510) has the molecular formula C12H12N2O4S
and a molecular weight of 280.30 g/mol. Its IUPAC name is 4-hydroxy-6-oxo-1-[1-(1,3-thiazol-2-yl)propyl]pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-hydroxy-6-oxo-1-[1-(1,3-thiazol-2-yl)propyl]pyridine-2-carboxylic acid |
| PubChem CID | 114207510 |
| Molecular Formula | C12H12N2O4S |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 4-hydroxy-6-oxo-1-[1-(1,3-thiazol-2-yl)propyl]pyridine-2-carboxylic acid |
| SMILES | CCC(c1nccs1)n1c(C(=O)O)cc(O)cc1=O |
| InChI | InChI=1S/C12H12N2O4S/c1-2-8(11-13-3-4-19-11)14-9(12(17)18)5-7(15)6-10(14)16/h3-6,8,15H,2H2,1H3,(H,17,18) |
| InChIKey | YQFXFSMVWQZWQQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-hydroxy-6-oxo-1-[1-(1,3-thiazol-2-yl)propyl]pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-6-oxo-1-[1-(1,3-thiazol-2-yl)propyl]pyridine-2-carboxylic acid?
The IUPAC name of 4-hydroxy-6-oxo-1-[1-(1,3-thiazol-2-yl)propyl]pyridine-2-carboxylic acid (CID 114207510) is 4-hydroxy-6-oxo-1-[1-(1,3-thiazol-2-yl)propyl]pyridine-2-carboxylic acid.
What is the SMILES notation for 4-hydroxy-6-oxo-1-[1-(1,3-thiazol-2-yl)propyl]pyridine-2-carboxylic acid?
The canonical SMILES for 4-hydroxy-6-oxo-1-[1-(1,3-thiazol-2-yl)propyl]pyridine-2-carboxylic acid is CCC(c1nccs1)n1c(C(=O)O)cc(O)cc1=O.
What is the InChIKey of 4-hydroxy-6-oxo-1-[1-(1,3-thiazol-2-yl)propyl]pyridine-2-carboxylic acid?
The InChIKey is YQFXFSMVWQZWQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O4S/c1-2-8(11-13-3-4-19-11)14-9(12(17)18)5-7(15)6-10(14)16/h3-6,8,15H,2H2,1H3,(H,17,18).
What are the key properties of 4-hydroxy-6-oxo-1-[1-(1,3-thiazol-2-yl)propyl]pyridine-2-carboxylic acid?
4-hydroxy-6-oxo-1-[1-(1,3-thiazol-2-yl)propyl]pyridine-2-carboxylic acid has a molecular weight of 280.30 g/mol, XLogP of 1.71, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-6-oxo-1-[1-(1,3-thiazol-2-yl)propyl]pyridine-2-carboxylic acid is sourced from PubChem (CID 114207510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).