C13H24N4 — CID 114207826
N-(cyclooctylmethyl)-1-(1H-1,2,4-triazol-5-yl)ethanamine (PubChem CID 114207826) has the molecular formula C13H24N4 and a molecular weight of 236.36 g/mol. Its IUPAC name is N-(cyclooctylmethyl)-1-(1H-1,2,4-triazol-5-yl)ethanamine.
| Compound Name | N-(cyclooctylmethyl)-1-(1H-1,2,4-triazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 114207826 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | N-(cyclooctylmethyl)-1-(1H-1,2,4-triazol-5-yl)ethanamine |
| SMILES | CC(NCC1CCCCCCC1)c1ncn[nH]1 |
| InChI | InChI=1S/C13H24N4/c1-11(13-15-10-16-17-13)14-9-12-7-5-3-2-4-6-8-12/h10-12,14H,2-9H2,1H3,(H,15,16,17) |
| InChIKey | NMXDWNRSIFXHEJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |