C13H26N2O2 — CID 114207874
ethyl N-(2-amino-1-cyclooctylethyl)carbamate (PubChem CID 114207874) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is ethyl N-(2-amino-1-cyclooctylethyl)carbamate.
| Compound Name | ethyl N-(2-amino-1-cyclooctylethyl)carbamate |
|---|---|
| PubChem CID | 114207874 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | ethyl N-(2-amino-1-cyclooctylethyl)carbamate |
| SMILES | CCOC(=O)NC(CN)C1CCCCCCC1 |
| InChI | InChI=1S/C13H26N2O2/c1-2-17-13(16)15-12(10-14)11-8-6-4-3-5-7-9-11/h11-12H,2-10,14H2,1H3,(H,15,16) |
| InChIKey | ZZAJEBFJMSDYAF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |