C26H43NO5Si2 — CID 11420791
(1R,4S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxo(213C)prop-1-ynyl]cyclopent-2-ene-1-carbonitrile (PubChem CID 11420791) has the molecular formula C26H43NO5Si2 and a molecular weight of 506.80 g/mol. Its IUPAC name is (1R,4S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxo(213C)prop-1-ynyl]cyclopent-2-ene-1-carbonitrile.
| Compound Name | (1R,4S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxo(213C)prop-1-ynyl]cyclopent-2-ene-1-carbonitrile |
|---|---|
| PubChem CID | 11420791 |
| Molecular Formula | C26H43NO5Si2 |
| Molecular Weight | 506.80 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | (1R,4S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxo(213C)prop-1-ynyl]cyclopent-2-ene-1-carbonitrile |
| SMILES | CC1(C)OC[C@H](C(=O)[13C]#CC2=C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@]2(C#N)O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C26H43NO5Si2/c1-23(2,3)33(9,10)31-20-15-19(13-14-21(28)22-17-29-25(7,8)30-22)26(16-20,18-27)32-34(11,12)24(4,5)6/h15,20,22H,16-17H2,1-12H3/t20-,22-,26+/m1/s1/i14+1 |
| InChIKey | RGRNYVPYODECKJ-AGRURLTISA-N |
| XLogP | 5.72 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.80 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|