About 3,3-dimethyl-2-N-(6-propoxypyrazin-2-yl)butane-1,2-diamine
3,3-dimethyl-2-N-(6-propoxypyrazin-2-yl)butane-1,2-diamine (PubChem CID 114208188) has the molecular formula C13H24N4O
and a molecular weight of 252.36 g/mol. Its IUPAC name is 3,3-dimethyl-2-N-(6-propoxypyrazin-2-yl)butane-1,2-diamine.
Molecular Properties
| Compound Name | 3,3-dimethyl-2-N-(6-propoxypyrazin-2-yl)butane-1,2-diamine |
| PubChem CID | 114208188 |
| Molecular Formula | C13H24N4O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | 3,3-dimethyl-2-N-(6-propoxypyrazin-2-yl)butane-1,2-diamine |
| SMILES | CCCOc1cncc(NC(CN)C(C)(C)C)n1 |
| InChI | InChI=1S/C13H24N4O/c1-5-6-18-12-9-15-8-11(17-12)16-10(7-14)13(2,3)4/h8-10H,5-7,14H2,1-4H3,(H,16,17) |
| InChIKey | UUZUHIGNFXUSIP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3,3-dimethyl-2-N-(6-propoxypyrazin-2-yl)butane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-2-N-(6-propoxypyrazin-2-yl)butane-1,2-diamine?
The IUPAC name of 3,3-dimethyl-2-N-(6-propoxypyrazin-2-yl)butane-1,2-diamine (CID 114208188) is 3,3-dimethyl-2-N-(6-propoxypyrazin-2-yl)butane-1,2-diamine.
What is the SMILES notation for 3,3-dimethyl-2-N-(6-propoxypyrazin-2-yl)butane-1,2-diamine?
The canonical SMILES for 3,3-dimethyl-2-N-(6-propoxypyrazin-2-yl)butane-1,2-diamine is CCCOc1cncc(NC(CN)C(C)(C)C)n1.
What is the InChIKey of 3,3-dimethyl-2-N-(6-propoxypyrazin-2-yl)butane-1,2-diamine?
The InChIKey is UUZUHIGNFXUSIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N4O/c1-5-6-18-12-9-15-8-11(17-12)16-10(7-14)13(2,3)4/h8-10H,5-7,14H2,1-4H3,(H,16,17).
What are the key properties of 3,3-dimethyl-2-N-(6-propoxypyrazin-2-yl)butane-1,2-diamine?
3,3-dimethyl-2-N-(6-propoxypyrazin-2-yl)butane-1,2-diamine has a molecular weight of 252.36 g/mol, XLogP of 2.05, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-2-N-(6-propoxypyrazin-2-yl)butane-1,2-diamine is sourced from PubChem (CID 114208188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).