C15H27NOS — CID 114208623
N-[[5-(2-ethylbutoxymethyl)thiophen-2-yl]methyl]propan-1-amine (PubChem CID 114208623) has the molecular formula C15H27NOS and a molecular weight of 269.45 g/mol. Its IUPAC name is N-[[5-(2-ethylbutoxymethyl)thiophen-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[5-(2-ethylbutoxymethyl)thiophen-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 114208623 |
| Molecular Formula | C15H27NOS |
| Molecular Weight | 269.45 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | N-[[5-(2-ethylbutoxymethyl)thiophen-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc(COCC(CC)CC)s1 |
| InChI | InChI=1S/C15H27NOS/c1-4-9-16-10-14-7-8-15(18-14)12-17-11-13(5-2)6-3/h7-8,13,16H,4-6,9-12H2,1-3H3 |
| InChIKey | MYVVWZDAWXNZPI-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.45 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|