C30H42O5S — CID 11420931
(13R,17S)-13-[2-[3-(butylsulfonylmethyl)phenoxy]ethyl]-17-hydroxy-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 11420931) has the molecular formula C30H42O5S and a molecular weight of 514.73 g/mol. Its IUPAC name is (13R,17S)-13-[2-[3-(butylsulfonylmethyl)phenoxy]ethyl]-17-hydroxy-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (13R,17S)-13-[2-[3-(butylsulfonylmethyl)phenoxy]ethyl]-17-hydroxy-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 11420931 |
| Molecular Formula | C30H42O5S |
| Molecular Weight | 514.73 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | (13R,17S)-13-[2-[3-(butylsulfonylmethyl)phenoxy]ethyl]-17-hydroxy-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CCCCS(=O)(=O)Cc1cccc(OCC[C@]23CCC4C5CCC(=O)C=C5CCC4C2CC[C@@H]3O)c1 |
| InChI | InChI=1S/C30H42O5S/c1-2-3-17-36(33,34)20-21-5-4-6-24(18-21)35-16-15-30-14-13-26-25-10-8-23(31)19-22(25)7-9-27(26)28(30)11-12-29(30)32/h4-6,18-19,25-29,32H,2-3,7-17,20H2,1H3/t25?,26?,27?,28?,29-,30+/m0/s1 |
| InChIKey | WUHUNKJMUWFGTM-IFNBDZAXSA-N |
| XLogP | 5.65 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.73 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |