About 4-(4,4-dimethylpentoxy)-2,3-dihydroinden-1-one
4-(4,4-dimethylpentoxy)-2,3-dihydroinden-1-one (PubChem CID 114209493) has the molecular formula C16H22O2
and a molecular weight of 246.35 g/mol. Its IUPAC name is 4-(4,4-dimethylpentoxy)-2,3-dihydroinden-1-one.
Molecular Properties
| Compound Name | 4-(4,4-dimethylpentoxy)-2,3-dihydroinden-1-one |
| PubChem CID | 114209493 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 4-(4,4-dimethylpentoxy)-2,3-dihydroinden-1-one |
| SMILES | CC(C)(C)CCCOc1cccc2c1CCC2=O |
| InChI | InChI=1S/C16H22O2/c1-16(2,3)10-5-11-18-15-7-4-6-12-13(15)8-9-14(12)17/h4,6-7H,5,8-11H2,1-3H3 |
| InChIKey | PLRYVDYEMJJSFB-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(4,4-dimethylpentoxy)-2,3-dihydroinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,4-dimethylpentoxy)-2,3-dihydroinden-1-one?
The IUPAC name of 4-(4,4-dimethylpentoxy)-2,3-dihydroinden-1-one (CID 114209493) is 4-(4,4-dimethylpentoxy)-2,3-dihydroinden-1-one.
What is the SMILES notation for 4-(4,4-dimethylpentoxy)-2,3-dihydroinden-1-one?
The canonical SMILES for 4-(4,4-dimethylpentoxy)-2,3-dihydroinden-1-one is CC(C)(C)CCCOc1cccc2c1CCC2=O.
What is the InChIKey of 4-(4,4-dimethylpentoxy)-2,3-dihydroinden-1-one?
The InChIKey is PLRYVDYEMJJSFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O2/c1-16(2,3)10-5-11-18-15-7-4-6-12-13(15)8-9-14(12)17/h4,6-7H,5,8-11H2,1-3H3.
What are the key properties of 4-(4,4-dimethylpentoxy)-2,3-dihydroinden-1-one?
4-(4,4-dimethylpentoxy)-2,3-dihydroinden-1-one has a molecular weight of 246.35 g/mol, XLogP of 4.02, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,4-dimethylpentoxy)-2,3-dihydroinden-1-one is sourced from PubChem (CID 114209493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).