C15H21ClO2 — CID 114209497
1-[3-chloro-4-(4,4-dimethylpentoxy)phenyl]ethanone (PubChem CID 114209497) has the molecular formula C15H21ClO2 and a molecular weight of 268.78 g/mol. Its IUPAC name is 1-[3-chloro-4-(4,4-dimethylpentoxy)phenyl]ethanone.
| Compound Name | 1-[3-chloro-4-(4,4-dimethylpentoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 114209497 |
| Molecular Formula | C15H21ClO2 |
| Molecular Weight | 268.78 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 1-[3-chloro-4-(4,4-dimethylpentoxy)phenyl]ethanone |
| SMILES | CC(=O)c1ccc(OCCCC(C)(C)C)c(Cl)c1 |
| InChI | InChI=1S/C15H21ClO2/c1-11(17)12-6-7-14(13(16)10-12)18-9-5-8-15(2,3)4/h6-7,10H,5,8-9H2,1-4H3 |
| InChIKey | XVRRJULGKVSDIS-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.78 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|