C25H26BrNO4S — CID 11420958
[(1S,2R,4R)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 2-bromo-3-phenylazirine-2-carboxylate (PubChem CID 11420958) has the molecular formula C25H26BrNO4S and a molecular weight of 516.46 g/mol. Its IUPAC name is [(1S,2R,4R)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 2-bromo-3-phenylazirine-2-carboxylate.
| Compound Name | [(1S,2R,4R)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 2-bromo-3-phenylazirine-2-carboxylate |
|---|---|
| PubChem CID | 11420958 |
| Molecular Formula | C25H26BrNO4S |
| Molecular Weight | 516.46 g/mol |
| Exact Mass | 515.08 |
| IUPAC Name | [(1S,2R,4R)-1-(benzenesulfonylmethyl)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 2-bromo-3-phenylazirine-2-carboxylate |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(CS(=O)(=O)c1ccccc1)[C@H](OC(=O)C1(Br)N=C1c1ccccc1)C2 |
| InChI | InChI=1S/C25H26BrNO4S/c1-23(2)18-13-14-24(23,16-32(29,30)19-11-7-4-8-12-19)20(15-18)31-22(28)25(26)21(27-25)17-9-5-3-6-10-17/h3-12,18,20H,13-16H2,1-2H3/t18-,20-,24-,25?/m1/s1 |
| InChIKey | RMFORHUFFQMSLM-AZVRKDMKSA-N |
| XLogP | 4.79 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.46 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|