C16H25NO — CID 114209780
3-amino-1-(4,4-dimethylpentyl)-2,3-dihydroinden-1-ol (PubChem CID 114209780) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is 3-amino-1-(4,4-dimethylpentyl)-2,3-dihydroinden-1-ol.
| Compound Name | 3-amino-1-(4,4-dimethylpentyl)-2,3-dihydroinden-1-ol |
|---|---|
| PubChem CID | 114209780 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | 3-amino-1-(4,4-dimethylpentyl)-2,3-dihydroinden-1-ol |
| SMILES | CC(C)(C)CCCC1(O)CC(N)c2ccccc21 |
| InChI | InChI=1S/C16H25NO/c1-15(2,3)9-6-10-16(18)11-14(17)12-7-4-5-8-13(12)16/h4-5,7-8,14,18H,6,9-11,17H2,1-3H3 |
| InChIKey | UEDKGDWRYGTTEJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |